C13H20N4O4 — CID 140666144
tert-butyl N-[4-(2-aminooxyethoxy)pyridine-2-carboximidoyl]carbamate (PubChem CID 140666144) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2-aminooxyethoxy)pyridine-2-carboximidoyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-aminooxyethoxy)pyridine-2-carboximidoyl]carbamate |
|---|---|
| PubChem CID | 140666144 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | tert-butyl N-[4-(2-aminooxyethoxy)pyridine-2-carboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cc(OCCON)ccn1 |
| InChI | InChI=1S/C13H20N4O4/c1-13(2,3)21-12(18)17-11(14)10-8-9(4-5-16-10)19-6-7-20-15/h4-5,8H,6-7,15H2,1-3H3,(H2,14,17,18) |
| InChIKey | QMFPPRIXKZZGLJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|