C17H20N2O3S — CID 138059480
tert-butyl N-(6-prop-2-enoxy-1-benzothiophene-2-carboximidoyl)carbamate (PubChem CID 138059480) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is tert-butyl N-(6-prop-2-enoxy-1-benzothiophene-2-carboximidoyl)carbamate.
| Compound Name | tert-butyl N-(6-prop-2-enoxy-1-benzothiophene-2-carboximidoyl)carbamate |
|---|---|
| PubChem CID | 138059480 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | tert-butyl N-(6-prop-2-enoxy-1-benzothiophene-2-carboximidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cc2ccc(OCC=C)cc2s1 |
| InChI | InChI=1S/C17H20N2O3S/c1-5-8-21-12-7-6-11-9-14(23-13(11)10-12)15(18)19-16(20)22-17(2,3)4/h5-7,9-10H,1,8H2,2-4H3,(H2,18,19,20) |
| InChIKey | QCNDVOMFXWKBAI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|