C15H14O3S — CID 13452866
prop-2-enyl 5-prop-2-enoxy-1-benzothiophene-2-carboxylate (PubChem CID 13452866) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is prop-2-enyl 5-prop-2-enoxy-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-prop-2-enoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 13452866 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | prop-2-enyl 5-prop-2-enoxy-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc(OCC=C)ccc2s1 |
| InChI | InChI=1S/C15H14O3S/c1-3-7-17-12-5-6-13-11(9-12)10-14(19-13)15(16)18-8-4-2/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | FTQFJNOFPBNQQA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|