C30H30NO5PS — CID 178108412
prop-2-enyl 5-[[[(1-ethoxy-1-oxo-3-phenylpropan-2-yl)amino]-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 178108412) has the molecular formula C30H30NO5PS and a molecular weight of 547.61 g/mol. Its IUPAC name is prop-2-enyl 5-[[[(1-ethoxy-1-oxo-3-phenylpropan-2-yl)amino]-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[[[(1-ethoxy-1-oxo-3-phenylpropan-2-yl)amino]-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 178108412 |
| Molecular Formula | C30H30NO5PS |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | prop-2-enyl 5-[[[(1-ethoxy-1-oxo-3-phenylpropan-2-yl)amino]-phenoxyphosphanyl]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc(CP(NC(Cc3ccccc3)C(=O)OCC)Oc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C30H30NO5PS/c1-3-17-35-30(33)28-20-24-18-23(15-16-27(24)38-28)21-37(36-25-13-9-6-10-14-25)31-26(29(32)34-4-2)19-22-11-7-5-8-12-22/h3,5-16,18,20,26,31H,1,4,17,19,21H2,2H3 |
| InChIKey | DQUHZYHQICMQHO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|