C26H30NO6PS — CID 170038415
prop-2-enyl 5-[[[[(2S)-1-[(2R)-butan-2-yl]oxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 170038415) has the molecular formula C26H30NO6PS and a molecular weight of 515.57 g/mol. Its IUPAC name is prop-2-enyl 5-[[[[(2S)-1-[(2R)-butan-2-yl]oxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[[[[(2S)-1-[(2R)-butan-2-yl]oxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 170038415 |
| Molecular Formula | C26H30NO6PS |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | prop-2-enyl 5-[[[[(2S)-1-[(2R)-butan-2-yl]oxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc(CP(=O)(N[C@@H](C)C(=O)O[C@H](C)CC)Oc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C26H30NO6PS/c1-5-14-31-26(29)24-16-21-15-20(12-13-23(21)35-24)17-34(30,33-22-10-8-7-9-11-22)27-19(4)25(28)32-18(3)6-2/h5,7-13,15-16,18-19H,1,6,14,17H2,2-4H3,(H,27,30)/t18-,19+,34?/m1/s1 |
| InChIKey | BEHRERSFBFYQSK-URGHJZDVSA-N |
| XLogP | 6.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|