C30H36NO6P — CID 170039224
prop-2-enyl 7-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]naphthalene-2-carboxylate (PubChem CID 170039224) has the molecular formula C30H36NO6P and a molecular weight of 537.59 g/mol. Its IUPAC name is prop-2-enyl 7-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]naphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 7-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 170039224 |
| Molecular Formula | C30H36NO6P |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | prop-2-enyl 7-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]methyl]naphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2ccc(CP(=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc3ccccc3)cc2c1 |
| InChI | InChI=1S/C30H36NO6P/c1-5-17-35-30(33)26-16-15-25-14-13-24(18-27(25)19-26)21-38(34,37-28-11-9-8-10-12-28)31-22(4)29(32)36-20-23(6-2)7-3/h5,8-16,18-19,22-23H,1,6-7,17,20-21H2,2-4H3,(H,31,34)/t22-,38?/m0/s1 |
| InChIKey | KBWHQOOMUWKPSC-CJAHMYNBSA-N |
| XLogP | 6.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|