C32H34NO6P — CID 170039228
prop-2-enyl 7-[[[[(2S)-1-butoxy-1-oxopropan-2-yl]amino]-naphthalen-1-yloxyphosphoryl]methyl]naphthalene-2-carboxylate (PubChem CID 170039228) has the molecular formula C32H34NO6P and a molecular weight of 559.60 g/mol. Its IUPAC name is prop-2-enyl 7-[[[[(2S)-1-butoxy-1-oxopropan-2-yl]amino]-naphthalen-1-yloxyphosphoryl]methyl]naphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 7-[[[[(2S)-1-butoxy-1-oxopropan-2-yl]amino]-naphthalen-1-yloxyphosphoryl]methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 170039228 |
| Molecular Formula | C32H34NO6P |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | prop-2-enyl 7-[[[[(2S)-1-butoxy-1-oxopropan-2-yl]amino]-naphthalen-1-yloxyphosphoryl]methyl]naphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2ccc(CP(=O)(N[C@@H](C)C(=O)OCCCC)Oc3cccc4ccccc34)cc2c1 |
| InChI | InChI=1S/C32H34NO6P/c1-4-6-19-38-31(34)23(3)33-40(36,39-30-13-9-11-26-10-7-8-12-29(26)30)22-24-14-15-25-16-17-27(21-28(25)20-24)32(35)37-18-5-2/h5,7-17,20-21,23H,2,4,6,18-19,22H2,1,3H3,(H,33,36)/t23-,40?/m0/s1 |
| InChIKey | JIOCXMHMPGQMAL-RVSAPWAISA-N |
| XLogP | 7.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|