C21H27ClNO6P — CID 123688107
3-chloropropyl 2-[[(2-methyl-3-oxobutoxy)-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 123688107) has the molecular formula C21H27ClNO6P and a molecular weight of 455.88 g/mol. Its IUPAC name is 3-chloropropyl 2-[[(2-methyl-3-oxobutoxy)-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 3-chloropropyl 2-[[(2-methyl-3-oxobutoxy)-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123688107 |
| Molecular Formula | C21H27ClNO6P |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-chloropropyl 2-[[(2-methyl-3-oxobutoxy)-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(=O)C(C)COP(=O)(NC(C)C(=O)OCCCCl)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C21H27ClNO6P/c1-15(17(3)24)14-28-30(26,23-16(2)21(25)27-13-7-12-22)29-20-11-6-9-18-8-4-5-10-19(18)20/h4-6,8-11,15-16H,7,12-14H2,1-3H3,(H,23,26) |
| InChIKey | UPORHJCCCZGDIR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|