C22H28NO7P — CID 130437776
cyclopentyl (2S)-2-[[1,3-dioxolan-2-ylmethoxy(naphthalen-1-yloxy)phosphoryl]amino]propanoate (PubChem CID 130437776) has the molecular formula C22H28NO7P and a molecular weight of 449.44 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[1,3-dioxolan-2-ylmethoxy(naphthalen-1-yloxy)phosphoryl]amino]propanoate.
| Compound Name | cyclopentyl (2S)-2-[[1,3-dioxolan-2-ylmethoxy(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130437776 |
| Molecular Formula | C22H28NO7P |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | cyclopentyl (2S)-2-[[1,3-dioxolan-2-ylmethoxy(naphthalen-1-yloxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OCC1OCCO1)Oc1cccc2ccccc12)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C22H28NO7P/c1-16(22(24)29-18-9-3-4-10-18)23-31(25,28-15-21-26-13-14-27-21)30-20-12-6-8-17-7-2-5-11-19(17)20/h2,5-8,11-12,16,18,21H,3-4,9-10,13-15H2,1H3,(H,23,25)/t16-,31?/m0/s1 |
| InChIKey | WSYPTISDACBSGK-YDIHDLSKSA-N |
| XLogP | 4.18 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|