C31H38IN6O9P — CID 90149809
cyclohexyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 90149809) has the molecular formula C31H38IN6O9P and a molecular weight of 796.56 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90149809 |
| Molecular Formula | C31H38IN6O9P |
| Molecular Weight | 796.56 g/mol |
| Exact Mass | 796.15 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1nc(I)n2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C31H38IN6O9P/c1-17(27(40)45-19-12-5-4-6-13-19)37-48(42,47-21-15-9-11-18-10-7-8-14-20(18)21)44-16-22-24(39)31(2,41)28(46-22)38-25-23(34-29(38)32)26(43-3)36-30(33)35-25/h7-11,14-15,17,19,22,24,28,39,41H,4-6,12-13,16H2,1-3H3,(H,37,42)(H2,33,35,36)/t17-,22+,24+,28+,31+,48?/m0/s1 |
| InChIKey | PMCUKBOPPOJRKX-ONNZKAHBSA-N |
| XLogP | 4.24 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|