C31H41N6O9P — CID 91274653
2-(2-amino-6-methoxypurin-9-yl)-5-[[[(1-cyclobutyloxy-1-hydroxy-3-methylbutan-2-yl)amino]-naphthalen-1-yloxyphosphoryl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 91274653) has the molecular formula C31H41N6O9P and a molecular weight of 672.68 g/mol. Its IUPAC name is 2-(2-amino-6-methoxypurin-9-yl)-5-[[[(1-cyclobutyloxy-1-hydroxy-3-methylbutan-2-yl)amino]-naphthalen-1-yloxyphosphoryl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | 2-(2-amino-6-methoxypurin-9-yl)-5-[[[(1-cyclobutyloxy-1-hydroxy-3-methylbutan-2-yl)amino]-naphthalen-1-yloxyphosphoryl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91274653 |
| Molecular Formula | C31H41N6O9P |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 2-(2-amino-6-methoxypurin-9-yl)-5-[[[(1-cyclobutyloxy-1-hydroxy-3-methylbutan-2-yl)amino]-naphthalen-1-yloxyphosphoryl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | COc1nc(N)nc2c1ncn2C1OC(COP(=O)(NC(C(C)C)C(O)OC2CCC2)Oc2cccc3ccccc23)C(O)C1(C)O |
| InChI | InChI=1S/C31H41N6O9P/c1-17(2)23(28(39)44-19-11-8-12-19)36-47(41,46-21-14-7-10-18-9-5-6-13-20(18)21)43-15-22-25(38)31(3,40)29(45-22)37-16-33-24-26(37)34-30(32)35-27(24)42-4/h5-7,9-10,13-14,16-17,19,22-23,25,28-29,38-40H,8,11-12,15H2,1-4H3,(H,36,41)(H2,32,34,35) |
| InChIKey | OQEQYIDRCMBFRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 205.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|