C33H37N6O8PS — CID 46852792
[(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 46852792) has the molecular formula C33H37N6O8PS and a molecular weight of 708.73 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 46852792 |
| Molecular Formula | C33H37N6O8PS |
| Molecular Weight | 708.73 g/mol |
| Exact Mass | 708.21 |
| IUPAC Name | [(1S)-1-phenylethyl] (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CSc1nc(N)nc2c1ncn2C1O[C@H](COP(=O)(N[C@@H](C)C(=O)O[C@@H](C)c2ccccc2)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C33H37N6O8PS/c1-19(30(41)45-20(2)21-11-6-5-7-12-21)38-48(43,47-24-16-10-14-22-13-8-9-15-23(22)24)44-17-25-27(40)33(3,42)31(46-25)39-18-35-26-28(39)36-32(34)37-29(26)49-4/h5-16,18-20,25,27,31,40,42H,17H2,1-4H3,(H,38,43)(H2,34,36,37)/t19-,20-,25+,27+,31?,33+,48?/m0/s1 |
| InChIKey | IDSRYAVHKYTJGM-SRPZSIIWSA-N |
| XLogP | 4.78 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|