C25H29N6O8PS — CID 90083279
2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoic acid (PubChem CID 90083279) has the molecular formula C25H29N6O8PS and a molecular weight of 604.58 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoic acid.
| Compound Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90083279 |
| Molecular Formula | C25H29N6O8PS |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoic acid |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=S)(NC(C)C(=O)O)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C25H29N6O8PS/c1-13(22(33)34)30-40(41,39-16-10-6-8-14-7-4-5-9-15(14)16)37-11-17-19(32)25(2,35)23(38-17)31-12-27-18-20(31)28-24(26)29-21(18)36-3/h4-10,12-13,17,19,23,32,35H,11H2,1-3H3,(H,30,41)(H,33,34)(H2,26,28,29)/t13?,17-,19-,23-,25-,40?/m1/s1 |
| InChIKey | TZNFBFLNGOCRTF-JHKUTFGDSA-N |
| XLogP | 1.96 |
| TPSA | 196.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|