C25H34N5O8PS — CID 66800609
propan-2-yl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-methoxy-2-methylpurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 66800609) has the molecular formula C25H34N5O8PS and a molecular weight of 595.62 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-methoxy-2-methylpurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-methoxy-2-methylpurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 66800609 |
| Molecular Formula | C25H34N5O8PS |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-3,4-dihydroxy-5-(6-methoxy-2-methylpurin-9-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | COc1nc(C)nc2c1ncn2[C@@H]1O[C@H](COP(=S)(NC(C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C25H34N5O8PS/c1-14(2)36-23(32)15(3)29-39(40,38-17-10-8-7-9-11-17)35-12-18-20(31)25(5,33)24(37-18)30-13-26-19-21(30)27-16(4)28-22(19)34-6/h7-11,13-15,18,20,24,31,33H,12H2,1-6H3,(H,29,40)/t15?,18-,20-,24-,25-,39?/m1/s1 |
| InChIKey | KRMNJOZZUXMNDR-UIAXLORLSA-N |
| XLogP | 2.40 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|