C24H32N5O10P — CID 127032393
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-dimethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 127032393) has the molecular formula C24H32N5O10P and a molecular weight of 581.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-dimethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-dimethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 127032393 |
| Molecular Formula | C24H32N5O10P |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-dimethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OC)nc(OC)nc32)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H32N5O10P/c1-6-36-21(31)14(2)28-40(33,39-15-10-8-7-9-11-15)37-12-16-18(30)24(3,32)22(38-16)29-13-25-17-19(29)26-23(35-5)27-20(17)34-4/h7-11,13-14,16,18,22,30,32H,6,12H2,1-5H3,(H,28,33)/t14-,16+,18+,22+,24+,40?/m0/s1 |
| InChIKey | SJGJVAIKRNGNAP-HEOQURLSSA-N |
| XLogP | 1.60 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|