C24H28N7O9P — CID 66778442
2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoic acid (PubChem CID 66778442) has the molecular formula C24H28N7O9P and a molecular weight of 589.50 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 66778442 |
| Molecular Formula | C24H28N7O9P |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | 2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoic acid |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COP(=O)(NC(C)C(=O)O)Oc2ccc3ncccc3c2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C24H28N7O9P/c1-12(21(33)34)30-41(36,40-14-6-7-15-13(9-14)5-4-8-26-15)38-10-16-18(32)24(2,35)22(39-16)31-11-27-17-19(31)28-23(25)29-20(17)37-3/h4-9,11-12,16,18,22,32,35H,10H2,1-3H3,(H,30,36)(H,33,34)(H2,25,28,29)/t12?,16-,18-,22?,24-,41?/m1/s1 |
| InChIKey | WACYAFKADSJDKL-PNAVYQLFSA-N |
| XLogP | 1.24 |
| TPSA | 226.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|