C29H35IN7O10P — CID 90163739
oxan-4-yl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoate (PubChem CID 90163739) has the molecular formula C29H35IN7O10P and a molecular weight of 799.52 g/mol. Its IUPAC name is oxan-4-yl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoate.
| Compound Name | oxan-4-yl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90163739 |
| Molecular Formula | C29H35IN7O10P |
| Molecular Weight | 799.52 g/mol |
| Exact Mass | 799.12 |
| IUPAC Name | oxan-4-yl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-quinolin-6-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1nc(I)n2C1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC2CCOCC2)Oc2ccc3ncccc3c2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C29H35IN7O10P/c1-15(25(39)45-17-8-11-43-12-9-17)36-48(41,47-18-6-7-19-16(13-18)5-4-10-32-19)44-14-20-22(38)29(2,40)26(46-20)37-23-21(33-27(37)30)24(42-3)35-28(31)34-23/h4-7,10,13,15,17,20,22,26,38,40H,8-9,11-12,14H2,1-3H3,(H,36,41)(H2,31,34,35)/t15-,20+,22+,26?,29+,48?/m0/s1 |
| InChIKey | ZXODVJKDMMJXOK-ISKBNJKNSA-N |
| XLogP | 2.48 |
| TPSA | 224.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|