C32H34IN6O9P — CID 90163715
benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 90163715) has the molecular formula C32H34IN6O9P and a molecular weight of 804.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90163715 |
| Molecular Formula | C32H34IN6O9P |
| Molecular Weight | 804.53 g/mol |
| Exact Mass | 804.12 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1nc(I)n2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCc2ccccc2)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C32H34IN6O9P/c1-18(28(41)45-16-19-10-5-4-6-11-19)38-49(43,48-22-15-9-13-20-12-7-8-14-21(20)22)46-17-23-25(40)32(2,42)29(47-23)39-26-24(35-30(39)33)27(44-3)37-31(34)36-26/h4-15,18,23,25,29,40,42H,16-17H2,1-3H3,(H,38,43)(H2,34,36,37)/t18-,23+,25+,29+,32+,49?/m0/s1 |
| InChIKey | YDWOPGDBCJXGDS-XLQKHPDBSA-N |
| XLogP | 4.11 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|