C23H29IN7O10P — CID 90149864
2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-oxo-2-phenylmethoxyethyl)amino]phosphoryl]amino]acetic acid (PubChem CID 90149864) has the molecular formula C23H29IN7O10P and a molecular weight of 721.40 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-oxo-2-phenylmethoxyethyl)amino]phosphoryl]amino]acetic acid.
| Compound Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-oxo-2-phenylmethoxyethyl)amino]phosphoryl]amino]acetic acid |
|---|---|
| PubChem CID | 90149864 |
| Molecular Formula | C23H29IN7O10P |
| Molecular Weight | 721.40 g/mol |
| Exact Mass | 721.08 |
| IUPAC Name | 2-[[[(2R,3R,4R,5R)-5-(2-amino-8-iodo-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(2-oxo-2-phenylmethoxyethyl)amino]phosphoryl]amino]acetic acid |
| SMILES | COc1nc(N)nc2c1nc(I)n2[C@@H]1O[C@H](COP(=O)(NCC(=O)O)NCC(=O)OCc2ccccc2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C23H29IN7O10P/c1-23(36)17(35)13(41-20(23)31-18-16(28-21(31)24)19(38-2)30-22(25)29-18)11-40-42(37,26-8-14(32)33)27-9-15(34)39-10-12-6-4-3-5-7-12/h3-7,13,17,20,35-36H,8-11H2,1-2H3,(H,32,33)(H2,25,29,30)(H2,26,27,37)/t13-,17-,20-,23-,42?/m1/s1 |
| InChIKey | HFFGQZCZMLFKIM-RAERZQOVSA-N |
| XLogP | 0.16 |
| TPSA | 242.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|