C21H24IN6O9P — CID 90149962
CID 90149962 (PubChem CID 90149962) has the molecular formula C21H24IN6O9P and a molecular weight of 662.33 g/mol.
| Compound Name | CID 90149962 |
|---|---|
| PubChem CID | 90149962 |
| Molecular Formula | C21H24IN6O9P |
| Molecular Weight | 662.33 g/mol |
| Exact Mass | 662.04 |
| IUPAC Name | — |
| SMILES | COc1nc(N)nc2c1nc(I)n2[C@@H]1O[C@H](COc2ccccc2O/[P+]([O-])=N/C(C)C(=O)O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C21H24IN6O9P/c1-9(17(30)31)27-38(33)37-11-7-5-4-6-10(11)35-8-12-14(29)21(2,32)18(36-12)28-15-13(24-19(28)22)16(34-3)26-20(23)25-15/h4-7,9,12,14,18,29,32H,8H2,1-3H3,(H,30,31)(H2,23,25,26)/t9?,12-,14-,18-,21-/m1/s1 |
| InChIKey | FAFCYWWUPNHQKS-UEFQYHNWSA-N |
| XLogP | 0.82 |
| TPSA | 219.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|