C26H28IN6O9P — CID 90149996
CID 90149996 (PubChem CID 90149996) has the molecular formula C26H28IN6O9P and a molecular weight of 726.42 g/mol.
| Compound Name | CID 90149996 |
|---|---|
| PubChem CID | 90149996 |
| Molecular Formula | C26H28IN6O9P |
| Molecular Weight | 726.42 g/mol |
| Exact Mass | 726.07 |
| IUPAC Name | — |
| SMILES | CCOc1nc(N)nc2c1nc(I)n2C1O[C@H](COc2ccc3ccccc3c2O/[P+]([O-])=N\C(C)C(=O)O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C26H28IN6O9P/c1-4-39-21-17-20(30-25(28)31-21)33(24(27)29-17)23-26(3,37)19(34)16(41-23)11-40-15-10-9-13-7-5-6-8-14(13)18(15)42-43(38)32-12(2)22(35)36/h5-10,12,16,19,23,34,37H,4,11H2,1-3H3,(H,35,36)(H2,28,30,31)/t12?,16-,19-,23?,26-/m1/s1 |
| InChIKey | FIJJRZJYVJIWQP-GQYKHNJESA-N |
| XLogP | 2.36 |
| TPSA | 219.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|