C32H31F2N6O9P — CID 66778715
CID 66778715 (PubChem CID 66778715) has the molecular formula C32H31F2N6O9P and a molecular weight of 712.60 g/mol.
| Compound Name | CID 66778715 |
|---|---|
| PubChem CID | 66778715 |
| Molecular Formula | C32H31F2N6O9P |
| Molecular Weight | 712.60 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | — |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COc2ccc3ccccc3c2O/[P+]([O-])=N\[C@@H](C)C(=O)OCc2ccc(F)cc2F)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C32H31F2N6O9P/c1-16(29(42)47-13-18-8-10-19(33)12-21(18)34)39-50(44)49-25-20-7-5-4-6-17(20)9-11-22(25)46-14-23-26(41)32(2,43)30(48-23)40-15-36-24-27(40)37-31(35)38-28(24)45-3/h4-12,15-16,23,26,30,41,43H,13-14H2,1-3H3,(H2,35,37,38)/t16-,23+,26+,30?,32+/m0/s1 |
| InChIKey | FWVCEVVAUBSAQH-RGZWNUNZSA-N |
| XLogP | 3.30 |
| TPSA | 208.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|