C33H35F2N6O9P — CID 46852334
(2,4-difluorophenyl)methyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-ethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 46852334) has the molecular formula C33H35F2N6O9P and a molecular weight of 728.65 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-ethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | (2,4-difluorophenyl)methyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-ethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 46852334 |
| Molecular Formula | C33H35F2N6O9P |
| Molecular Weight | 728.65 g/mol |
| Exact Mass | 728.22 |
| IUPAC Name | (2,4-difluorophenyl)methyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-ethoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2C1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCc2ccc(F)cc2F)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C33H35F2N6O9P/c1-4-46-29-26-28(38-32(36)39-29)41(17-37-26)31-33(3,44)27(42)25(49-31)16-48-51(45,50-24-11-7-9-19-8-5-6-10-22(19)24)40-18(2)30(43)47-15-20-12-13-21(34)14-23(20)35/h5-14,17-18,25,27,31,42,44H,4,15-16H2,1-3H3,(H,40,45)(H2,36,38,39)/t18-,25+,27+,31?,33+,51?/m0/s1 |
| InChIKey | YXJLCRSAEOZPDS-UOVHHMRRSA-N |
| XLogP | 4.17 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|