C32H40FN6O8P — CID 71565746
cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 71565746) has the molecular formula C32H40FN6O8P and a molecular weight of 686.68 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71565746 |
| Molecular Formula | C32H40FN6O8P |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2cccc3ccccc23)[C@@H](F)[C@@]1(C)O |
| InChI | InChI=1S/C32H40FN6O8P/c1-4-43-28-25-27(36-31(34)37-28)39(18-35-25)30-32(3,41)26(33)24(46-30)17-44-48(42,38-19(2)29(40)45-21-13-6-5-7-14-21)47-23-16-10-12-20-11-8-9-15-22(20)23/h8-12,15-16,18-19,21,24,26,30,41H,4-7,13-14,17H2,1-3H3,(H,38,42)(H2,34,36,37)/t19-,24+,26+,30+,32+,48?/m0/s1 |
| InChIKey | CPIPYLDTJHAQIZ-WHHJPMMWSA-N |
| XLogP | 5.00 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|