C31H41N6O9P — CID 46853421
3,3-dimethylbutyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 46853421) has the molecular formula C31H41N6O9P and a molecular weight of 672.68 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 46853421 |
| Molecular Formula | C31H41N6O9P |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-[[[(2R,3R,4R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C31H41N6O9P/c1-18(27(39)43-15-14-30(2,3)4)36-47(41,46-21-13-9-11-19-10-7-8-12-20(19)21)44-16-22-24(38)31(5,40)28(45-22)37-17-33-23-25(37)34-29(32)35-26(23)42-6/h7-13,17-18,22,24,28,38,40H,14-16H2,1-6H3,(H,36,41)(H2,32,34,35)/t18-,22+,24+,28?,31+,47?/m0/s1 |
| InChIKey | JHGIECDRKRVVFM-NRBINZMHSA-N |
| XLogP | 3.74 |
| TPSA | 202.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|