C31H38N7O8P — CID 66576122
2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 66576122) has the molecular formula C31H38N7O8P and a molecular weight of 667.66 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66576122 |
| Molecular Formula | C31H38N7O8P |
| Molecular Weight | 667.66 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)C#N |
| InChI | InChI=1S/C31H38N7O8P/c1-18(27(40)43-16-30(2,3)4)37-47(41,46-21-13-9-11-19-10-7-8-12-20(19)21)44-14-22-24(39)31(5,15-32)28(45-22)38-17-34-23-25(38)35-29(33)36-26(23)42-6/h7-13,17-18,22,24,28,39H,14,16H2,1-6H3,(H,37,41)(H2,33,35,36)/t18-,22+,24+,28+,31+,47?/m0/s1 |
| InChIKey | ISMBAQFHYGUBGD-NSLZILBFSA-N |
| XLogP | 4.13 |
| TPSA | 205.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|