C31H40FN6O8P — CID 71565681
2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 71565681) has the molecular formula C31H40FN6O8P and a molecular weight of 674.67 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71565681 |
| Molecular Formula | C31H40FN6O8P |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](F)[C@@]1(C)O |
| InChI | InChI=1S/C31H40FN6O8P/c1-7-42-26-23-25(35-29(33)36-26)38(17-34-23)28-31(6,40)24(32)22(45-28)15-44-47(41,37-18(2)27(39)43-16-30(3,4)5)46-21-14-10-12-19-11-8-9-13-20(19)21/h8-14,17-18,22,24,28,40H,7,15-16H2,1-6H3,(H,37,41)(H2,33,35,36)/t18-,22+,24+,28+,31+,47?/m0/s1 |
| InChIKey | ZIBKJJCCMJMIGD-NSLZILBFSA-N |
| XLogP | 4.72 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|