C30H36N7O8P — CID 70914051
butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 70914051) has the molecular formula C30H36N7O8P and a molecular weight of 653.63 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70914051 |
| Molecular Formula | C30H36N7O8P |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(C#N)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C30H36N7O8P/c1-5-6-14-42-27(39)18(2)36-46(40,45-21-13-9-11-19-10-7-8-12-20(19)21)43-15-22-24(38)30(3,16-31)28(44-22)37-17-33-23-25(37)34-29(32)35-26(23)41-4/h7-13,17-18,22,24,28,38H,5-6,14-15H2,1-4H3,(H,36,40)(H2,32,34,35)/t18-,22+,24+,28+,30+,46?/m0/s1 |
| InChIKey | LZNXDCVXKZTHEB-PTUTUMMCSA-N |
| XLogP | 3.88 |
| TPSA | 205.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|