C26H34FN6O8P — CID 136506622
cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 136506622) has the molecular formula C26H34FN6O8P and a molecular weight of 608.56 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 136506622 |
| Molecular Formula | C26H34FN6O8P |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoro-4-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1F)Oc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C26H34FN6O8P/c1-15(23(35)39-16-9-5-3-6-10-16)32-42(37,41-17-11-7-4-8-12-17)38-13-18-20(27)26(2,36)24(40-18)33-14-29-19-21(33)30-25(28)31-22(19)34/h4,7-8,11-12,14-16,18,20,24,36H,3,5-6,9-10,13H2,1-2H3,(H,32,37)(H3,28,30,31,34)/t15-,18+,20+,24+,26+,42?/m0/s1 |
| InChIKey | SRDGKIMDAXVQDL-JUMSPBSPSA-N |
| XLogP | 2.75 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|