C27H33N6O7PS — CID 137153125
cyclohexyl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 137153125) has the molecular formula C27H33N6O7PS and a molecular weight of 616.64 g/mol. Its IUPAC name is cyclohexyl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 137153125 |
| Molecular Formula | C27H33N6O7PS |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | cyclohexyl 2-[[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-ethynyl-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | C#CC1(O)CC(COP(=S)(NC(C)C(=O)OC2CCCCC2)Oc2ccccc2)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C27H33N6O7PS/c1-3-27(36)14-20(39-25(27)33-16-29-21-22(33)30-26(28)31-23(21)34)15-37-41(42,40-19-12-8-5-9-13-19)32-17(2)24(35)38-18-10-6-4-7-11-18/h1,5,8-9,12-13,16-18,20,25,36H,4,6-7,10-11,14-15H2,2H3,(H,32,42)(H3,28,30,31,34) |
| InChIKey | RWSLODMSHFCYIM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 175.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|