C29H35N4O8PS — CID 156674351
cyclohexyl (2S)-2-[[[(2R,3R,4R,5S)-5-(5-amino-7-oxo-3,6-dihydropyrrolo[2,3-c]pyridin-3-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 156674351) has the molecular formula C29H35N4O8PS and a molecular weight of 630.66 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3R,4R,5S)-5-(5-amino-7-oxo-3,6-dihydropyrrolo[2,3-c]pyridin-3-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3R,4R,5S)-5-(5-amino-7-oxo-3,6-dihydropyrrolo[2,3-c]pyridin-3-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 156674351 |
| Molecular Formula | C29H35N4O8PS |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3R,4R,5S)-5-(5-amino-7-oxo-3,6-dihydropyrrolo[2,3-c]pyridin-3-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=S)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)O[C@H]1C1C=Nc2c1cc(N)[nH]c2=O |
| InChI | InChI=1S/C29H35N4O8PS/c1-3-29(37)25(34)22(40-26(29)21-15-31-24-20(21)14-23(30)32-27(24)35)16-38-42(43,41-19-12-8-5-9-13-19)33-17(2)28(36)39-18-10-6-4-7-11-18/h1,5,8-9,12-15,17-18,21-22,25-26,34,37H,4,6-7,10-11,16H2,2H3,(H,33,43)(H3,30,32,35)/t17-,21?,22+,25+,26-,29+,42?/m0/s1 |
| InChIKey | ZHKVHQDLZXFQDH-BZPJTGPTSA-N |
| XLogP | 2.42 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|