C26H31N6O8P — CID 121304233
cyclopentyl 2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 121304233) has the molecular formula C26H31N6O8P and a molecular weight of 586.54 g/mol. Its IUPAC name is cyclopentyl 2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclopentyl 2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 121304233 |
| Molecular Formula | C26H31N6O8P |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | cyclopentyl 2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C26H31N6O8P/c1-16(25(35)38-17-7-5-6-8-17)31-41(36,40-18-9-3-2-4-10-18)37-13-20-22(33)23(34)26(14-27,39-20)21-12-11-19-24(28)29-15-30-32(19)21/h2-4,9-12,15-17,20,22-23,33-34H,5-8,13H2,1H3,(H,31,36)(H2,28,29,30)/t16?,20-,22-,23-,26+,41?/m1/s1 |
| InChIKey | HEEJHCBJQDLCOX-ZIXSHAMCSA-N |
| XLogP | 1.82 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|