C28H33N6O8P — CID 163554930
cyclobutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate (PubChem CID 163554930) has the molecular formula C28H33N6O8P and a molecular weight of 612.58 g/mol. Its IUPAC name is cyclobutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclobutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163554930 |
| Molecular Formula | C28H33N6O8P |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | cyclobutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-cyclopropylphenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccc(C2CC2)cc1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C28H33N6O8P/c1-16(27(37)40-19-3-2-4-19)33-43(38,42-20-9-7-18(8-10-20)17-5-6-17)39-13-22-24(35)25(36)28(14-29,41-22)23-12-11-21-26(30)31-15-32-34(21)23/h7-12,15-17,19,22,24-25,35-36H,2-6,13H2,1H3,(H,33,38)(H2,30,31,32)/t16-,22+,24+,25+,28-,43?/m0/s1 |
| InChIKey | FMFOMTYGVFKLIE-OCDAONACSA-N |
| XLogP | 2.31 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|