C30H39N6O9P — CID 166913938
oxan-4-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate (PubChem CID 166913938) has the molecular formula C30H39N6O9P and a molecular weight of 658.65 g/mol. Its IUPAC name is oxan-4-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | oxan-4-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166913938 |
| Molecular Formula | C30H39N6O9P |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | oxan-4-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccc(C(C)(C)C)cc1)C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C30H39N6O9P/c1-18(28(39)43-20-11-13-41-14-12-20)35-46(40,45-21-7-5-19(6-8-21)29(2,3)4)42-15-23-25(37)26(38)30(16-31,44-23)24-10-9-22-27(32)33-17-34-36(22)24/h5-10,17-18,20,23,25-26,37-38H,11-15H2,1-4H3,(H,35,40)(H2,32,33,34)/t18-,23+,25+,26+,30-,46?/m0/s1 |
| InChIKey | KZCMADLPMCGKGF-RDQVAKFBSA-N |
| XLogP | 2.35 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|