C29H37N6O8P — CID 166914127
cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate (PubChem CID 166914127) has the molecular formula C29H37N6O8P and a molecular weight of 628.62 g/mol. Its IUPAC name is cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166914127 |
| Molecular Formula | C29H37N6O8P |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccc(C(C)(C)C)cc1)C(=O)OCC1CC1 |
| InChI | InChI=1S/C29H37N6O8P/c1-17(27(38)40-13-18-5-6-18)34-44(39,43-20-9-7-19(8-10-20)28(2,3)4)41-14-22-24(36)25(37)29(15-30,42-22)23-12-11-21-26(31)32-16-33-35(21)23/h7-12,16-18,22,24-25,36-37H,5-6,13-14H2,1-4H3,(H,34,39)(H2,31,32,33)/t17-,22+,24+,25+,29-,44?/m0/s1 |
| InChIKey | XJVFJYODMFLSJT-OARGDPAPSA-N |
| XLogP | 2.58 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|