C26H36N5O8P — CID 166913949
methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate (PubChem CID 166913949) has the molecular formula C26H36N5O8P and a molecular weight of 577.58 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166913949 |
| Molecular Formula | C26H36N5O8P |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H36N5O8P/c1-15(24(34)36-6)30-40(35,39-17-9-7-16(8-10-17)25(2,3)4)37-13-19-21(32)22(33)26(5,38-19)20-12-11-18-23(27)28-14-29-31(18)20/h7-12,14-15,19,21-22,32-33H,13H2,1-6H3,(H,30,35)(H2,27,28,29)/t15-,19+,21+,22+,26-,40?/m0/s1 |
| InChIKey | ZXUBPVDUHDSNBR-KSDUBQBSSA-N |
| XLogP | 2.30 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|