C25H34N5O8P — CID 126692942
propan-2-yl 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 126692942) has the molecular formula C25H34N5O8P and a molecular weight of 563.55 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 126692942 |
| Molecular Formula | C25H34N5O8P |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CC(C)OC(=O)C(C)(C)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H34N5O8P/c1-15(2)36-23(33)24(3,4)29-39(34,38-16-9-7-6-8-10-16)35-13-18-20(31)21(32)25(5,37-18)19-12-11-17-22(26)27-14-28-30(17)19/h6-12,14-15,18,20-21,31-32H,13H2,1-5H3,(H,29,34)(H2,26,27,28)/t18-,20-,21-,25+,39?/m1/s1 |
| InChIKey | ORHYVVOHRJCUFV-QKZDKTKSSA-N |
| XLogP | 2.17 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|