C24H32N5O8P — CID 138525641
ethyl 2-[[[(3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 138525641) has the molecular formula C24H32N5O8P and a molecular weight of 549.52 g/mol. Its IUPAC name is ethyl 2-[[[(3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[[(3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 138525641 |
| Molecular Formula | C24H32N5O8P |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | ethyl 2-[[[(3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NP(=O)(OCC1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H32N5O8P/c1-5-34-22(32)23(2,3)28-38(33,37-15-9-7-6-8-10-15)35-13-17-19(30)20(31)24(4,36-17)18-12-11-16-21(25)26-14-27-29(16)18/h6-12,14,17,19-20,30-31H,5,13H2,1-4H3,(H,28,33)(H2,25,26,27)/t17?,19-,20-,24+,38?/m1/s1 |
| InChIKey | NHNPEZVFMIPOKK-ALJNWZDFSA-N |
| XLogP | 1.78 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|