C26H34N5O8P — CID 126693017
cyclopentyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126693017) has the molecular formula C26H34N5O8P and a molecular weight of 575.56 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclopentyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126693017 |
| Molecular Formula | C26H34N5O8P |
| Molecular Weight | 575.56 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | cyclopentyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C26H34N5O8P/c1-16(25(34)37-17-8-6-7-9-17)30-40(35,39-18-10-4-3-5-11-18)36-14-20-22(32)23(33)26(2,38-20)21-13-12-19-24(27)28-15-29-31(19)21/h3-5,10-13,15-17,20,22-23,32-33H,6-9,14H2,1-2H3,(H,30,35)(H2,27,28,29)/t16-,20+,22+,23+,26-,40?/m0/s1 |
| InChIKey | FLYPKSNUBPYIAG-PGKZCLSCSA-N |
| XLogP | 2.31 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|