C27H36N5O8P — CID 174115253
cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174115253) has the molecular formula C27H36N5O8P and a molecular weight of 589.59 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174115253 |
| Molecular Formula | C27H36N5O8P |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@@]1(C)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C27H36N5O8P/c1-17(26(35)38-18-9-5-3-6-10-18)31-41(36,40-19-11-7-4-8-12-19)37-15-27(2)24(34)22(33)23(39-27)20-13-14-21-25(28)29-16-30-32(20)21/h4,7-8,11-14,16-18,22-24,33-34H,3,5-6,9-10,15H2,1-2H3,(H,31,36)(H2,28,29,30)/t17-,22-,23-,24-,27+,41-/m0/s1 |
| InChIKey | BXUMEXAXKFMMTJ-SJYLPMFUSA-N |
| XLogP | 2.92 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|