C27H31F2N6O8P — CID 166023266
(4,4-difluorocyclohexyl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166023266) has the molecular formula C27H31F2N6O8P and a molecular weight of 636.55 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (4,4-difluorocyclohexyl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166023266 |
| Molecular Formula | C27H31F2N6O8P |
| Molecular Weight | 636.55 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | (4,4-difluorocyclohexyl) (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@@](=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H31F2N6O8P/c1-16(25(38)41-17-9-11-27(28,29)12-10-17)34-44(39,43-18-5-3-2-4-6-18)40-14-26(13-30)23(37)21(36)22(42-26)19-7-8-20-24(31)32-15-33-35(19)20/h2-8,15-17,21-23,36-37H,9-12,14H2,1H3,(H,34,39)(H2,31,32,33)/t16-,21-,22-,23-,26+,44+/m0/s1 |
| InChIKey | SYMNBZVGWBBMGO-RPPKNXHFSA-N |
| XLogP | 2.67 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|