C31H39N6O9P — CID 167685573
cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-3,4-dihydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 167685573) has the molecular formula C31H39N6O9P and a molecular weight of 670.66 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-3,4-dihydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-3,4-dihydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 167685573 |
| Molecular Formula | C31H39N6O9P |
| Molecular Weight | 670.66 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2R,3S,4R,5S)-2-cyano-3,4-dihydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)C(=O)Nc1ncnn2c([C@@H]3O[C@](C#N)(COP(=O)(N[C@@H](C)C(=O)OC4CCCCC4)Oc4ccccc4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C31H39N6O9P/c1-19(2)29(40)35-28-24-15-14-23(37(24)34-18-33-28)26-25(38)27(39)31(16-32,45-26)17-43-47(42,46-22-12-8-5-9-13-22)36-20(3)30(41)44-21-10-6-4-7-11-21/h5,8-9,12-15,18-21,25-27,38-39H,4,6-7,10-11,17H2,1-3H3,(H,36,42)(H,33,34,35,40)/t20-,25-,26-,27-,31+,47?/m0/s1 |
| InChIKey | QPLCFEVFILJJEJ-BKSMQTMNSA-N |
| XLogP | 3.44 |
| TPSA | 206.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|