C25H29N6O8P — CID 156835352
cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835352) has the molecular formula C25H29N6O8P and a molecular weight of 572.52 g/mol. Its IUPAC name is cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835352 |
| Molecular Formula | C25H29N6O8P |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCC1CC1 |
| InChI | InChI=1S/C25H29N6O8P/c1-15(24(34)36-11-16-7-8-16)30-40(35,39-17-5-3-2-4-6-17)37-13-25(12-26)22(33)20(32)21(38-25)18-9-10-19-23(27)28-14-29-31(18)19/h2-6,9-10,14-16,20-22,32-33H,7-8,11,13H2,1H3,(H,30,35)(H2,27,28,29)/t15-,20-,21-,22-,25+,40?/m0/s1 |
| InChIKey | DVIJBBZHNMPATJ-QFIBXCADSA-N |
| XLogP | 1.50 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|