C26H33N6O7P — CID 156835297
(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[[[(2S)-1-(cyclobutylmethoxy)propan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolane-2-carbonitrile (PubChem CID 156835297) has the molecular formula C26H33N6O7P and a molecular weight of 572.56 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[[[(2S)-1-(cyclobutylmethoxy)propan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolane-2-carbonitrile.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[[[(2S)-1-(cyclobutylmethoxy)propan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolane-2-carbonitrile |
|---|---|
| PubChem CID | 156835297 |
| Molecular Formula | C26H33N6O7P |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-[[[[(2S)-1-(cyclobutylmethoxy)propan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-3,4-dihydroxyoxolane-2-carbonitrile |
| SMILES | C[C@@H](COCC1CCC1)N[P@](=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H33N6O7P/c1-17(12-36-13-18-6-5-7-18)31-40(35,39-19-8-3-2-4-9-19)37-15-26(14-27)24(34)22(33)23(38-26)20-10-11-21-25(28)29-16-30-32(20)21/h2-4,8-11,16-18,22-24,33-34H,5-7,12-13,15H2,1H3,(H,31,35)(H2,28,29,30)/t17-,22-,23-,24-,26+,40-/m0/s1 |
| InChIKey | YZHUAVNSUBFOAG-PWUUUBCISA-N |
| XLogP | 2.37 |
| TPSA | 186.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|