C35H43N6O12P — CID 166731819
oxan-4-yl 2-[[[(2R,3S,4S,5S)-2-cyano-5-[4-(propanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166731819) has the molecular formula C35H43N6O12P and a molecular weight of 770.73 g/mol. Its IUPAC name is oxan-4-yl 2-[[[(2R,3S,4S,5S)-2-cyano-5-[4-(propanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | oxan-4-yl 2-[[[(2R,3S,4S,5S)-2-cyano-5-[4-(propanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166731819 |
| Molecular Formula | C35H43N6O12P |
| Molecular Weight | 770.73 g/mol |
| Exact Mass | 770.27 |
| IUPAC Name | oxan-4-yl 2-[[[(2R,3S,4S,5S)-2-cyano-5-[4-(propanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)Nc1ncnn2c([C@@H]3O[C@](C#N)(COP(=O)(NC(C)C(=O)OC4CCOCC4)Oc4ccccc4)[C@@H](OC(=O)CC)[C@H]3OC(=O)CC)ccc12 |
| InChI | InChI=1S/C35H43N6O12P/c1-5-27(42)39-33-26-14-13-25(41(26)38-21-37-33)30-31(50-28(43)6-2)32(51-29(44)7-3)35(19-36,52-30)20-48-54(46,53-24-11-9-8-10-12-24)40-22(4)34(45)49-23-15-17-47-18-16-23/h8-14,21-23,30-32H,5-7,15-18,20H2,1-4H3,(H,40,46)(H,37,38,39,42)/t22?,30-,31-,32-,35+,54?/m0/s1 |
| InChIKey | VHXMPMCOSLXZTG-FDQNVSFESA-N |
| XLogP | 3.96 |
| TPSA | 228.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|