C31H37N6O10P — CID 166740905
cyclobutyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166740905) has the molecular formula C31H37N6O10P and a molecular weight of 684.64 g/mol. Its IUPAC name is cyclobutyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166740905 |
| Molecular Formula | C31H37N6O10P |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | cyclobutyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ncnn23)O[C@](C#N)(COP(=O)(N[C@@H](C)C(=O)OC2CCC2)Oc2ccccc2)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C31H37N6O10P/c1-4-24(38)44-27-26(22-14-15-23-29(33)34-18-35-37(22)23)46-31(16-32,28(27)45-25(39)5-2)17-42-48(41,47-21-10-7-6-8-11-21)36-19(3)30(40)43-20-12-9-13-20/h6-8,10-11,14-15,18-20,26-28H,4-5,9,12-13,17H2,1-3H3,(H,36,41)(H2,33,34,35)/t19-,26-,27-,28-,31+,48?/m0/s1 |
| InChIKey | SIAJKYKOPDBTGF-KFTSFOOHSA-N |
| XLogP | 3.57 |
| TPSA | 215.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|