C29H34N5O10P — CID 170231836
methyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170231836) has the molecular formula C29H34N5O10P and a molecular weight of 643.59 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170231836 |
| Molecular Formula | C29H34N5O10P |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ccnn23)O[C@](C#N)(CO[P@](=O)(N[C@@H](C)C(=O)OC)Oc2ccccc2)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C29H34N5O10P/c1-5-23(35)41-26-25(22-13-12-21-20(31)14-15-32-34(21)22)43-29(16-30,27(26)42-24(36)6-2)17-40-45(38,33-18(3)28(37)39-4)44-19-10-8-7-9-11-19/h7-15,18,25-27H,5-6,17,31H2,1-4H3,(H,33,38)/t18-,25-,26-,27-,29+,45+/m0/s1 |
| InChIKey | XNZWWAZJWODXTE-IVFSSLDKSA-N |
| XLogP | 3.25 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|