C31H40FN4O10P — CID 161453280
propan-2-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 161453280) has the molecular formula C31H40FN4O10P and a molecular weight of 678.65 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 161453280 |
| Molecular Formula | C31H40FN4O10P |
| Molecular Weight | 678.65 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-(fluoromethyl)-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](c2ccc3c(N)ccnn23)O[C@](CF)(CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C31H40FN4O10P/c1-6-25(37)43-28-27(24-14-13-23-22(33)15-16-34-36(23)24)45-31(17-32,29(28)44-26(38)7-2)18-41-47(40,46-21-11-9-8-10-12-21)35-20(5)30(39)42-19(3)4/h8-16,19-20,27-29H,6-7,17-18,33H2,1-5H3,(H,35,40)/t20-,27-,28-,29-,31+,47-/m0/s1 |
| InChIKey | JWZVUGGWHVPPHB-HJFHJWBASA-N |
| XLogP | 4.47 |
| TPSA | 179.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|