C27H33FN5O10P — CID 156835933
ethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835933) has the molecular formula C27H33FN5O10P and a molecular weight of 637.56 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835933 |
| Molecular Formula | C27H33FN5O10P |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(CF)O[C@@H](c2ccc3c(N)ncnn23)[C@H](OC(C)=O)[C@@H]1OC(C)=O)Oc1ccccc1 |
| InChI | InChI=1S/C27H33FN5O10P/c1-5-38-26(36)16(2)32-44(37,43-19-9-7-6-8-10-19)39-14-27(13-28)24(41-18(4)35)23(40-17(3)34)22(42-27)20-11-12-21-25(29)30-15-31-33(20)21/h6-12,15-16,22-24H,5,13-14H2,1-4H3,(H,32,37)(H2,29,30,31)/t16-,22-,23-,24-,27+,44?/m0/s1 |
| InChIKey | MXPPUXRPOIMDHO-FVGXPURASA-N |
| XLogP | 2.70 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|