C23H29FN5O7P — CID 156835775
ethyl (2S)-2-[[[(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835775) has the molecular formula C23H29FN5O7P and a molecular weight of 537.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835775 |
| Molecular Formula | C23H29FN5O7P |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | ethyl (2S)-2-[[[(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@]1(CF)C[C@@H](O)[C@H](c2ccc3c(N)ncnn23)O1)Oc1ccccc1 |
| InChI | InChI=1S/C23H29FN5O7P/c1-3-33-22(31)15(2)28-37(32,36-16-7-5-4-6-8-16)34-13-23(12-24)11-19(30)20(35-23)17-9-10-18-21(25)26-14-27-29(17)18/h4-10,14-15,19-20,30H,3,11-13H2,1-2H3,(H,28,32)(H2,25,26,27)/t15-,19+,20-,23+,37?/m0/s1 |
| InChIKey | LOSHXFULYZRDBZ-STSUHKIRSA-N |
| XLogP | 2.59 |
| TPSA | 159.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|